2,4,7,9-Tetramethyl-5-Decyne-4,7-Diol, Mixture Of ( /-) And Meso, 98%, 100g, Each
$ 106.60
|
|
Details
Specifications empirical formula: c14h26o2linear formula: (ch3)2chch2c(ch3)(oh)c≡cc(ch3)(oh)ch2ch(ch3)2formula weight: 226.36Mdl number: mfcd00008942purity: 98%boiling point: 255 °c(lit.)Melting point: 42-44 °c(lit.)Signal word: warninghazard statements: h319precautionary statements: p305 p351 p338risk statements (europe): 36safety statements (europe): 26-37/39hazard codes (europe): xi
Additional Information
| SKU | 5448663 |
|---|---|
| UOM | Each |
| UNSPSC | 12352100 |
| Manufacturer Part Number | 278386-100G |
| CAS Number | 126-86-3 |
| Is Hazardous | Yes |
| HS Code | 2905399000 |
|---|---|
| UN Number | UN 3077 |
| Proper Shipping Name | 2,4,7,9-Tetramethyl-5-decyne-4,7-diol |
| Packaging Group | PG III |
| Hazardous Class | NA |
| Label | ![]() |
| Molecular Formula | C14H26O2 |
| EC Number | 204-809-1 |
| Hazard Statement | H317-H318-H412 |
| Precautionary Statements | P305+P351+P338 |
| Risk Statements | 36-52/53 |
| GHS | GHS05,GHS07 |
| GHS (Pictogram) | ![]() ![]() |
| Safety Statements | 26-37/39-61-39-37/29 |
| Hazard Code | Xi |
| Signal Word | Danger |



